Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tellurium pieces, 99.9999% (metals basis), zone refined, Thermo Scientific Chemicals
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |
Indium foil, 0.25mm (0.01in) thick, Puratronic™, 99.9975% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
Platinum wire, 2.0mm (0.08in) dia, annealed, 99.95% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Titanium Thinfoil, 0.006mm (0.0002in) thick, 99.6% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Platinum rod, 6.35mm (0.25in) dia, Premion™, 99.99% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Ammonium molybdate (di), Mo 56.5%
CAS: 27546-07-2 Molecular Formula: H2MoO4 Molecular Weight (g/mol): 161.96 MDL Number: MFCD00010882 InChI Key: VLAPMBHFAWRUQP-UHFFFAOYSA-L Synonym: Ammonium dimolybdate
| CAS | 27546-07-2 |
|---|---|
| Molecular Weight (g/mol) | 161.96 |
| MDL Number | MFCD00010882 |
| Synonym | Ammonium dimolybdate |
| InChI Key | VLAPMBHFAWRUQP-UHFFFAOYSA-L |
| Molecular Formula | H2MoO4 |
Calcium hydroxide, 99.995%, (trace metal basis)
CAS: 1305-62-0 Molecular Formula: CaH2O2 Molecular Weight (g/mol): 74.09 MDL Number: MFCD00010901 InChI Key: AXCZMVOFGPJBDE-UHFFFAOYSA-L Synonym: calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid PubChem CID: 6093208 ChEBI: CHEBI:31341 IUPAC Name: calcium;dihydroxide SMILES: [OH-].[OH-].[Ca++]
| PubChem CID | 6093208 |
|---|---|
| CAS | 1305-62-0 |
| Molecular Weight (g/mol) | 74.09 |
| ChEBI | CHEBI:31341 |
| MDL Number | MFCD00010901 |
| SMILES | [OH-].[OH-].[Ca++] |
| Synonym | calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid |
| IUPAC Name | calcium;dihydroxide |
| InChI Key | AXCZMVOFGPJBDE-UHFFFAOYSA-L |
| Molecular Formula | CaH2O2 |
Tetrakis(dimethylsiloxy)silane, 97%
CAS: 17082-47-2 Molecular Formula: C8H24O4Si5 Molecular Weight (g/mol): 324.70 MDL Number: MFCD00053848 InChI Key: UOUILILVWRHZSH-UHFFFAOYSA-N Synonym: tetrakis dimethylsilyl orthosilicate
| CAS | 17082-47-2 |
|---|---|
| Molecular Weight (g/mol) | 324.70 |
| MDL Number | MFCD00053848 |
| Synonym | tetrakis dimethylsilyl orthosilicate |
| InChI Key | UOUILILVWRHZSH-UHFFFAOYSA-N |
| Molecular Formula | C8H24O4Si5 |
1H,1H,2H,2H-Perfluorooctyltriethoxysilane, 97%
CAS: 51851-37-7 Molecular Formula: C14H19F13O3Si Molecular Weight (g/mol): 510.367 MDL Number: MFCD00042333 InChI Key: AVYKQOAMZCAHRG-UHFFFAOYSA-N Synonym: 1h,1h,2h,2h-perfluorooctyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,silane, triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,perfluorooctyl triethoxysilane,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyltriethoxysilan,triethoxy 1h,1h,2h,2h-perfluoro-1-octyl silane,tridecafluoro-1,1,2,2-tetrahydrooctyl triethoxysilane,1h,1h,2h,2h-perfluoroalkyltriethoxysilane,triethoxy-1h,1h,2h,2h-perfluoro-n-octylsilane PubChem CID: 103991 IUPAC Name: triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: CCO[Si](CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OCC)OCC
| PubChem CID | 103991 |
|---|---|
| CAS | 51851-37-7 |
| Molecular Weight (g/mol) | 510.367 |
| MDL Number | MFCD00042333 |
| SMILES | CCO[Si](CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OCC)OCC |
| Synonym | 1h,1h,2h,2h-perfluorooctyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,silane, triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,perfluorooctyl triethoxysilane,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyltriethoxysilan,triethoxy 1h,1h,2h,2h-perfluoro-1-octyl silane,tridecafluoro-1,1,2,2-tetrahydrooctyl triethoxysilane,1h,1h,2h,2h-perfluoroalkyltriethoxysilane,triethoxy-1h,1h,2h,2h-perfluoro-n-octylsilane |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | AVYKQOAMZCAHRG-UHFFFAOYSA-N |
| Molecular Formula | C14H19F13O3Si |
1,1,2,2-Tetramethyl-1,2-diphenyldisilane, 95%
CAS: 1145-98-8 Molecular Formula: C16H22Si2 Molecular Weight (g/mol): 270.522 MDL Number: MFCD00054786 InChI Key: IIOOIYHUTINYQO-UHFFFAOYSA-N Synonym: 1,2-diphenyltetramethyldisilane,1,1,2,2-tetramethyl-1,2-diphenyldisilane,disilane,1,1,2,2-tetramethyl-1,2-diphenyl,1,2-diphenyl-1,1,2,2-tetramethyldisilane,tetramethyldiphenyldisilan,amtsi083,tetramethyldisilane-1,2-diyldibenzene,bisphenyl-1,1,2,2-tetramethyldisilane,dimethyl phenyl silyl-dimethyl-phenylsilane,1,1,2,2-tetramethyldiphenyldisilane PubChem CID: 136916 IUPAC Name: [dimethyl(phenyl)silyl]-dimethyl-phenylsilane SMILES: C[Si](C)(C1=CC=CC=C1)[Si](C)(C)C2=CC=CC=C2
| PubChem CID | 136916 |
|---|---|
| CAS | 1145-98-8 |
| Molecular Weight (g/mol) | 270.522 |
| MDL Number | MFCD00054786 |
| SMILES | C[Si](C)(C1=CC=CC=C1)[Si](C)(C)C2=CC=CC=C2 |
| Synonym | 1,2-diphenyltetramethyldisilane,1,1,2,2-tetramethyl-1,2-diphenyldisilane,disilane,1,1,2,2-tetramethyl-1,2-diphenyl,1,2-diphenyl-1,1,2,2-tetramethyldisilane,tetramethyldiphenyldisilan,amtsi083,tetramethyldisilane-1,2-diyldibenzene,bisphenyl-1,1,2,2-tetramethyldisilane,dimethyl phenyl silyl-dimethyl-phenylsilane,1,1,2,2-tetramethyldiphenyldisilane |
| IUPAC Name | [dimethyl(phenyl)silyl]-dimethyl-phenylsilane |
| InChI Key | IIOOIYHUTINYQO-UHFFFAOYSA-N |
| Molecular Formula | C16H22Si2 |
Calcium DL-glycerate dihydrate
CAS: 67525-74-0 Molecular Formula: C3H5O4 Molecular Weight (g/mol): 105.07 MDL Number: MFCD00149289,MFCD00149288,MFCD00149289 InChI Key: RBNPOMFGQQGHHO-UWTATZPHSA-M Synonym: calciumdl-glycerate PubChem CID: 131883203 IUPAC Name: calcium;2,3-dihydroxypropanoic acid;dihydrate SMILES: OC[C@@H](O)C([O-])=O
| PubChem CID | 131883203 |
|---|---|
| CAS | 67525-74-0 |
| Molecular Weight (g/mol) | 105.07 |
| MDL Number | MFCD00149289,MFCD00149288,MFCD00149289 |
| SMILES | OC[C@@H](O)C([O-])=O |
| Synonym | calciumdl-glycerate |
| IUPAC Name | calcium;2,3-dihydroxypropanoic acid;dihydrate |
| InChI Key | RBNPOMFGQQGHHO-UWTATZPHSA-M |
| Molecular Formula | C3H5O4 |
Hafnium crystal bar milled chips, 99.7% (metals basis excluding Zr), Zr nominal 3%, Thermo Scientific Chemicals
CAS: 7440-58-6 Molecular Formula: Hf Molecular Weight (g/mol): 178.49 MDL Number: MFCD00011032 InChI Key: VBJZVLUMGGDVMO-UHFFFAOYSA-N Synonym: hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire PubChem CID: 23986 ChEBI: CHEBI:33343 IUPAC Name: hafnium SMILES: [Hf]
| PubChem CID | 23986 |
|---|---|
| CAS | 7440-58-6 |
| Molecular Weight (g/mol) | 178.49 |
| ChEBI | CHEBI:33343 |
| MDL Number | MFCD00011032 |
| SMILES | [Hf] |
| Synonym | hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire |
| IUPAC Name | hafnium |
| InChI Key | VBJZVLUMGGDVMO-UHFFFAOYSA-N |
| Molecular Formula | Hf |
Tellurium lump, typically 12mm (0.47 in.), 99.9999% (metals basis), Thermo Scientific Chemicals
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |
Thulium foil, 0.25mm (0.01in) thick, 99.9% (REO)
CAS: 7440-30-4 Molecular Formula: Tm Molecular Weight (g/mol): 168.93 MDL Number: MFCD00011281 InChI Key: FRNOGLGSGLTDKL-UHFFFAOYSA-N Synonym: tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic PubChem CID: 23961 ChEBI: CHEBI:33380 IUPAC Name: thulium SMILES: [Tm]
| PubChem CID | 23961 |
|---|---|
| CAS | 7440-30-4 |
| Molecular Weight (g/mol) | 168.93 |
| ChEBI | CHEBI:33380 |
| MDL Number | MFCD00011281 |
| SMILES | [Tm] |
| Synonym | tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic |
| IUPAC Name | thulium |
| InChI Key | FRNOGLGSGLTDKL-UHFFFAOYSA-N |
| Molecular Formula | Tm |
Tin shot, 2-4mm, Puratronic, 99.9999% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |